C13H22O3Si — CID 175454438
2-(2,6-dimethoxyphenyl)-2-trimethylsilylethanol (PubChem CID 175454438) has the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenyl)-2-trimethylsilylethanol.
| Compound Name | 2-(2,6-dimethoxyphenyl)-2-trimethylsilylethanol |
|---|---|
| PubChem CID | 175454438 |
| Molecular Formula | C13H22O3Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-(2,6-dimethoxyphenyl)-2-trimethylsilylethanol |
| SMILES | COc1cccc(OC)c1C(CO)[Si](C)(C)C |
| InChI | InChI=1S/C13H22O3Si/c1-15-10-7-6-8-11(16-2)13(10)12(9-14)17(3,4)5/h6-8,12,14H,9H2,1-5H3 |
| InChIKey | WUKIMMKNELOEGT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|