C27H32F4N8O2 — CID 175459756
1-tert-butyl-N-[[3-[4-[[(3S,4R)-4-fluoro-1-methylpiperidin-3-yl]amino]-1-(1,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide (PubChem CID 175459756) has the molecular formula C27H32F4N8O2 and a molecular weight of 576.60 g/mol. Its IUPAC name is 1-tert-butyl-N-[[3-[4-[[(3S,4R)-4-fluoro-1-methylpiperidin-3-yl]amino]-1-(1,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[[3-[4-[[(3S,4R)-4-fluoro-1-methylpiperidin-3-yl]amino]-1-(1,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 175459756 |
| Molecular Formula | C27H32F4N8O2 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 1-tert-butyl-N-[[3-[4-[[(3S,4R)-4-fluoro-1-methylpiperidin-3-yl]amino]-1-(1,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide |
| SMILES | CN1CC[C@@H](F)[C@@H](Nc2cccc3c2cc(-c2noc(CNC(=O)c4cnn(C(C)(C)C)c4)n2)n3C(F)C(F)F)C1 |
| InChI | InChI=1S/C27H32F4N8O2/c1-27(2,3)38-13-15(11-33-38)26(40)32-12-22-35-25(36-41-22)21-10-16-18(34-19-14-37(4)9-8-17(19)28)6-5-7-20(16)39(21)24(31)23(29)30/h5-7,10-11,13,17,19,23-24,34H,8-9,12,14H2,1-4H3,(H,32,40)/t17-,19+,24?/m1/s1 |
| InChIKey | RPLFECBNYOUJFA-HJZDTSKPSA-N |
| XLogP | 4.76 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |