C27H31F4N7O2 — CID 157047321
1-tert-butyl-N-[[3-[4-[[(1R,2S)-2-fluorocyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide (PubChem CID 157047321) has the molecular formula C27H31F4N7O2 and a molecular weight of 561.58 g/mol. Its IUPAC name is 1-tert-butyl-N-[[3-[4-[[(1R,2S)-2-fluorocyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[[3-[4-[[(1R,2S)-2-fluorocyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 157047321 |
| Molecular Formula | C27H31F4N7O2 |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 1-tert-butyl-N-[[3-[4-[[(1R,2S)-2-fluorocyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1cc(C(=O)NCc2nc(-c3cc4c(N[C@@H]5CCCC[C@@H]5F)cccc4n3CC(F)(F)F)no2)cn1 |
| InChI | InChI=1S/C27H31F4N7O2/c1-26(2,3)38-14-16(12-33-38)25(39)32-13-23-35-24(36-40-23)22-11-17-19(34-20-8-5-4-7-18(20)28)9-6-10-21(17)37(22)15-27(29,30)31/h6,9-12,14,18,20,34H,4-5,7-8,13,15H2,1-3H3,(H,32,39)/t18-,20+/m0/s1 |
| InChIKey | ANOVMIXNUXMIGQ-AZUAARDMSA-N |
| XLogP | 5.83 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |