C27H30F4N6O3 — CID 157048206
1-tert-butyl-N-[[3-[4-[[(3S,4S)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide (PubChem CID 157048206) has the molecular formula C27H30F4N6O3 and a molecular weight of 562.57 g/mol. Its IUPAC name is 1-tert-butyl-N-[[3-[4-[[(3S,4S)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[[3-[4-[[(3S,4S)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 157048206 |
| Molecular Formula | C27H30F4N6O3 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 1-tert-butyl-N-[[3-[4-[[(3S,4S)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide |
| SMILES | CC(C)(C)n1ccc(C(=O)NCc2nc(-c3cc4c(N[C@H]5CCOC[C@H]5F)cccc4n3CC(F)(F)F)no2)c1 |
| InChI | InChI=1S/C27H30F4N6O3/c1-26(2,3)36-9-7-16(13-36)25(38)32-12-23-34-24(35-40-23)22-11-17-19(33-20-8-10-39-14-18(20)28)5-4-6-21(17)37(22)15-27(29,30)31/h4-7,9,11,13,18,20,33H,8,10,12,14-15H2,1-3H3,(H,32,38)/t18-,20+/m1/s1 |
| InChIKey | PDXPRQHJGBJYKU-QUCCMNQESA-N |
| XLogP | 5.28 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |