C29H31F3N8O2 — CID 157047388
1-tert-butyl-N-[[3-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide (PubChem CID 157047388) has the molecular formula C29H31F3N8O2 and a molecular weight of 580.62 g/mol. Its IUPAC name is 1-tert-butyl-N-[[3-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[[3-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 157047388 |
| Molecular Formula | C29H31F3N8O2 |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 1-tert-butyl-N-[[3-[4-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide |
| SMILES | CC(C)(C)n1ccc(C(=O)NCc2nc(-c3cc4c(NC5CCn6ccnc6C5)cccc4n3CC(F)(F)F)no2)c1 |
| InChI | InChI=1S/C29H31F3N8O2/c1-28(2,3)39-11-7-18(16-39)27(41)34-15-25-36-26(37-42-25)23-14-20-21(5-4-6-22(20)40(23)17-29(30,31)32)35-19-8-10-38-12-9-33-24(38)13-19/h4-7,9,11-12,14,16,19,35H,8,10,13,15,17H2,1-3H3,(H,34,41) |
| InChIKey | UYTCXSQCIYAZDL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |