C29H35F4N7O2 — CID 157048236
1-tert-butyl-N-[[3-[4-[[(3S,4R)-1-ethyl-3-fluoropiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide (PubChem CID 157048236) has the molecular formula C29H35F4N7O2 and a molecular weight of 589.64 g/mol. Its IUPAC name is 1-tert-butyl-N-[[3-[4-[[(3S,4R)-1-ethyl-3-fluoropiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[[3-[4-[[(3S,4R)-1-ethyl-3-fluoropiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 157048236 |
| Molecular Formula | C29H35F4N7O2 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 1-tert-butyl-N-[[3-[4-[[(3S,4R)-1-ethyl-3-fluoropiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide |
| SMILES | CCN1CC[C@@H](Nc2cccc3c2cc(-c2noc(CNC(=O)c4ccn(C(C)(C)C)c4)n2)n3CC(F)(F)F)[C@@H](F)C1 |
| InChI | InChI=1S/C29H35F4N7O2/c1-5-38-11-10-22(20(30)16-38)35-21-7-6-8-23-19(21)13-24(40(23)17-29(31,32)33)26-36-25(42-37-26)14-34-27(41)18-9-12-39(15-18)28(2,3)4/h6-9,12-13,15,20,22,35H,5,10-11,14,16-17H2,1-4H3,(H,34,41)/t20-,22+/m0/s1 |
| InChIKey | SOTPMLQEWXLVRY-RBBKRZOGSA-N |
| XLogP | 5.58 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |