C26H29F4N7O3 — CID 157047988
1-tert-butyl-N-[[3-[4-[[(3S)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide (PubChem CID 157047988) has the molecular formula C26H29F4N7O3 and a molecular weight of 563.56 g/mol. Its IUPAC name is 1-tert-butyl-N-[[3-[4-[[(3S)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[[3-[4-[[(3S)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 157047988 |
| Molecular Formula | C26H29F4N7O3 |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 1-tert-butyl-N-[[3-[4-[[(3S)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrazole-4-carboxamide |
| SMILES | CC(C)(C)n1cc(C(=O)NCc2nc(-c3cc4c(NC5CCOC[C@H]5F)cccc4n3CC(F)(F)F)no2)cn1 |
| InChI | InChI=1S/C26H29F4N7O3/c1-25(2,3)37-12-15(10-32-37)24(38)31-11-22-34-23(35-40-22)21-9-16-18(33-19-7-8-39-13-17(19)27)5-4-6-20(16)36(21)14-26(28,29)30/h4-6,9-10,12,17,19,33H,7-8,11,13-14H2,1-3H3,(H,31,38)/t17-,19?/m1/s1 |
| InChIKey | GLTQKHWGRCCDSU-DUSLRRAJSA-N |
| XLogP | 4.67 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |