C29H32F4N6O4 — CID 157048452
N-[[3-[4-[[(3R,4R)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1-(4-methyloxan-4-yl)pyrrole-3-carboxamide (PubChem CID 157048452) has the molecular formula C29H32F4N6O4 and a molecular weight of 604.61 g/mol. Its IUPAC name is N-[[3-[4-[[(3R,4R)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1-(4-methyloxan-4-yl)pyrrole-3-carboxamide.
| Compound Name | N-[[3-[4-[[(3R,4R)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1-(4-methyloxan-4-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 157048452 |
| Molecular Formula | C29H32F4N6O4 |
| Molecular Weight | 604.61 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | N-[[3-[4-[[(3R,4R)-3-fluorooxan-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1-(4-methyloxan-4-yl)pyrrole-3-carboxamide |
| SMILES | CC1(n2ccc(C(=O)NCc3nc(-c4cc5c(N[C@@H]6CCOC[C@@H]6F)cccc5n4CC(F)(F)F)no3)c2)CCOCC1 |
| InChI | InChI=1S/C29H32F4N6O4/c1-28(7-11-41-12-8-28)38-9-5-18(15-38)27(40)34-14-25-36-26(37-43-25)24-13-19-21(35-22-6-10-42-16-20(22)30)3-2-4-23(19)39(24)17-29(31,32)33/h2-5,9,13,15,20,22,35H,6-8,10-12,14,16-17H2,1H3,(H,34,40)/t20-,22+/m0/s1 |
| InChIKey | LVSDKKVHQGJZNW-RBBKRZOGSA-N |
| XLogP | 5.05 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |