C24H21N5O4 — CID 175462334
1-(3-cyano-1-propan-2-ylindazol-5-yl)pyrazole-4-carboxylic acid;3-phenylprop-2-enoic acid (PubChem CID 175462334) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is 1-(3-cyano-1-propan-2-ylindazol-5-yl)pyrazole-4-carboxylic acid;3-phenylprop-2-enoic acid.
| Compound Name | 1-(3-cyano-1-propan-2-ylindazol-5-yl)pyrazole-4-carboxylic acid;3-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 175462334 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 1-(3-cyano-1-propan-2-ylindazol-5-yl)pyrazole-4-carboxylic acid;3-phenylprop-2-enoic acid |
| SMILES | CC(C)n1nc(C#N)c2cc(-n3cc(C(=O)O)cn3)ccc21.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C15H13N5O2.C9H8O2/c1-9(2)20-14-4-3-11(5-12(14)13(6-16)18-20)19-8-10(7-17-19)15(21)22;10-9(11)7-6-8-4-2-1-3-5-8/h3-5,7-9H,1-2H3,(H,21,22);1-7H,(H,10,11) |
| InChIKey | IKTOWKWVNCEVDN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|