C15H16N2O6 — CID 162310578
(E)-but-2-enedioic acid;1-propan-2-ylindazole-3-carboxylic acid (PubChem CID 162310578) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-propan-2-ylindazole-3-carboxylic acid.
| Compound Name | (E)-but-2-enedioic acid;1-propan-2-ylindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 162310578 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (E)-but-2-enedioic acid;1-propan-2-ylindazole-3-carboxylic acid |
| SMILES | CC(C)n1nc(C(=O)O)c2ccccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H12N2O2.C4H4O4/c1-7(2)13-9-6-4-3-5-8(9)10(12-13)11(14)15;5-3(6)1-2-4(7)8/h3-7H,1-2H3,(H,14,15);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UINIQHUPBLUVFQ-WLHGVMLRSA-N |
| XLogP | 2.03 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|