C22H23ClF4N2O5S — CID 175467202
5-(4-chloro-2-fluorophenoxy)-1-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 175467202) has the molecular formula C22H23ClF4N2O5S and a molecular weight of 538.95 g/mol. Its IUPAC name is 5-(4-chloro-2-fluorophenoxy)-1-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 5-(4-chloro-2-fluorophenoxy)-1-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 175467202 |
| Molecular Formula | C22H23ClF4N2O5S |
| Molecular Weight | 538.95 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 5-(4-chloro-2-fluorophenoxy)-1-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCOc1ccc(Cl)cc1F)N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H23ClF4N2O5S/c23-16-4-9-20(19(24)15-16)33-14-2-1-3-21(30)28-10-12-29(13-11-28)35(31,32)18-7-5-17(6-8-18)34-22(25,26)27/h4-9,15H,1-3,10-14H2 |
| InChIKey | APQRKJXYUJJNMC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.95 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|