2-ethoxyethanimidoyl chloride

C4H8ClNO — CID 175467520

IUPAC2-ethoxyethanimidoyl chloride
SMILES[H]/N=C(\Cl)COCC
InChIInChI=1S/C4H8ClNO/c1-2-7-3-4(5)6/h6H,2-3H2,1H3/b6-4-
InChIKeyXBAZFZUAYIWXGU-XQRVVYSFSA-N
MW121.57 g/mol
LogP1.24
Rot. Bonds3

About 2-ethoxyethanimidoyl chloride

2-ethoxyethanimidoyl chloride (PubChem CID 175467520) has the molecular formula C4H8ClNO and a molecular weight of 121.57 g/mol. Its IUPAC name is 2-ethoxyethanimidoyl chloride.

Molecular Properties

Compound Name2-ethoxyethanimidoyl chloride
PubChem CID175467520
Molecular FormulaC4H8ClNO
Molecular Weight121.57 g/mol
Exact Mass121.03
IUPAC Name2-ethoxyethanimidoyl chloride
SMILES[H]/N=C(\Cl)COCC
InChIInChI=1S/C4H8ClNO/c1-2-7-3-4(5)6/h6H,2-3H2,1H3/b6-4-
InChIKeyXBAZFZUAYIWXGU-XQRVVYSFSA-N
XLogP1.24
TPSA33.08 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500121.57
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 2-ethoxyethanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxyethanimidoyl chloride?
The IUPAC name of 2-ethoxyethanimidoyl chloride (CID 175467520) is 2-ethoxyethanimidoyl chloride.
What is the SMILES notation for 2-ethoxyethanimidoyl chloride?
The canonical SMILES for 2-ethoxyethanimidoyl chloride is [H]/N=C(\Cl)COCC.
What is the InChIKey of 2-ethoxyethanimidoyl chloride?
The InChIKey is XBAZFZUAYIWXGU-XQRVVYSFSA-N. The full InChI is InChI=1S/C4H8ClNO/c1-2-7-3-4(5)6/h6H,2-3H2,1H3/b6-4-.
What are the key properties of 2-ethoxyethanimidoyl chloride?
2-ethoxyethanimidoyl chloride has a molecular weight of 121.57 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethanimidoyl chloride is sourced from PubChem (CID 175467520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).