About 2-ethoxyethanimidoyl chloride
2-ethoxyethanimidoyl chloride (PubChem CID 175467520) has the molecular formula C4H8ClNO
and a molecular weight of 121.57 g/mol. Its IUPAC name is 2-ethoxyethanimidoyl chloride.
Molecular Properties
| Compound Name | 2-ethoxyethanimidoyl chloride |
| PubChem CID | 175467520 |
| Molecular Formula | C4H8ClNO |
| Molecular Weight | 121.57 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | 2-ethoxyethanimidoyl chloride |
| SMILES | [H]/N=C(\Cl)COCC |
| InChI | InChI=1S/C4H8ClNO/c1-2-7-3-4(5)6/h6H,2-3H2,1H3/b6-4- |
| InChIKey | XBAZFZUAYIWXGU-XQRVVYSFSA-N |
| XLogP | 1.24 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.57 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethanimidoyl chloride?
The IUPAC name of 2-ethoxyethanimidoyl chloride (CID 175467520) is 2-ethoxyethanimidoyl chloride.
What is the SMILES notation for 2-ethoxyethanimidoyl chloride?
The canonical SMILES for 2-ethoxyethanimidoyl chloride is [H]/N=C(\Cl)COCC.
What is the InChIKey of 2-ethoxyethanimidoyl chloride?
The InChIKey is XBAZFZUAYIWXGU-XQRVVYSFSA-N. The full InChI is InChI=1S/C4H8ClNO/c1-2-7-3-4(5)6/h6H,2-3H2,1H3/b6-4-.
What are the key properties of 2-ethoxyethanimidoyl chloride?
2-ethoxyethanimidoyl chloride has a molecular weight of 121.57 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethanimidoyl chloride is sourced from PubChem (CID 175467520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).