C9H9NO3 — CID 175468977
2-cyano-4-methyl-5-oxohepta-2,6-dienoic acid (PubChem CID 175468977) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 2-cyano-4-methyl-5-oxohepta-2,6-dienoic acid.
| Compound Name | 2-cyano-4-methyl-5-oxohepta-2,6-dienoic acid |
|---|---|
| PubChem CID | 175468977 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 2-cyano-4-methyl-5-oxohepta-2,6-dienoic acid |
| SMILES | C=CC(=O)C(C)C=C(C#N)C(=O)O |
| InChI | InChI=1S/C9H9NO3/c1-3-8(11)6(2)4-7(5-10)9(12)13/h3-4,6H,1H2,2H3,(H,12,13) |
| InChIKey | MHWFZZZVWNQPAA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|