C8H6N2O4 — CID 175098761
2,3-dicyanoprop-2-enoic acid;prop-2-enoic acid (PubChem CID 175098761) has the molecular formula C8H6N2O4 and a molecular weight of 194.15 g/mol. Its IUPAC name is 2,3-dicyanoprop-2-enoic acid;prop-2-enoic acid.
| Compound Name | 2,3-dicyanoprop-2-enoic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 175098761 |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2,3-dicyanoprop-2-enoic acid;prop-2-enoic acid |
| SMILES | C=CC(=O)O.N#CC=C(C#N)C(=O)O |
| InChI | InChI=1S/C5H2N2O2.C3H4O2/c6-2-1-4(3-7)5(8)9;1-2-3(4)5/h1H,(H,8,9);2H,1H2,(H,4,5) |
| InChIKey | WTOYLNRINADMEC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 122.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|