C21H23N5O2S — CID 175470698
N-(6-amino-5-methyl-3-pyridinyl)-2-[2-(1,3-benzothiazol-5-yl)-2-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 175470698) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[2-(1,3-benzothiazol-5-yl)-2-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[2-(1,3-benzothiazol-5-yl)-2-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 175470698 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[2-(1,3-benzothiazol-5-yl)-2-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCCCC2(C)c2ccc3scnc3c2)cnc1N |
| InChI | InChI=1S/C21H23N5O2S/c1-13-9-15(11-23-18(13)22)25-19(27)20(28)26-8-4-3-7-21(26,2)14-5-6-17-16(10-14)24-12-29-17/h5-6,9-12H,3-4,7-8H2,1-2H3,(H2,22,23)(H,25,27) |
| InChIKey | RRZLOHHUISXDQI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|