C15H19F3N4O4 — CID 175473844
[azetidine-3-carbonyl-[5-[2-methoxyethyl(methyl)amino]-2-pyridinyl]amino] 2,2,2-trifluoroacetate (PubChem CID 175473844) has the molecular formula C15H19F3N4O4 and a molecular weight of 376.34 g/mol. Its IUPAC name is [azetidine-3-carbonyl-[5-[2-methoxyethyl(methyl)amino]-2-pyridinyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [azetidine-3-carbonyl-[5-[2-methoxyethyl(methyl)amino]-2-pyridinyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 175473844 |
| Molecular Formula | C15H19F3N4O4 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | [azetidine-3-carbonyl-[5-[2-methoxyethyl(methyl)amino]-2-pyridinyl]amino] 2,2,2-trifluoroacetate |
| SMILES | COCCN(C)c1ccc(N(OC(=O)C(F)(F)F)C(=O)C2CNC2)nc1 |
| InChI | InChI=1S/C15H19F3N4O4/c1-21(5-6-25-2)11-3-4-12(20-9-11)22(13(23)10-7-19-8-10)26-14(24)15(16,17)18/h3-4,9-10,19H,5-8H2,1-2H3 |
| InChIKey | CYAPYRUVZUNYME-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|