C16H15BrFN5OS — CID 175476257
O-[2-(3-bromophenyl)-2-fluoro-1-(4-methyl-1,2,4-triazol-3-yl)propyl] imidazole-1-carbothioate (PubChem CID 175476257) has the molecular formula C16H15BrFN5OS and a molecular weight of 424.30 g/mol. Its IUPAC name is O-[2-(3-bromophenyl)-2-fluoro-1-(4-methyl-1,2,4-triazol-3-yl)propyl] imidazole-1-carbothioate.
| Compound Name | O-[2-(3-bromophenyl)-2-fluoro-1-(4-methyl-1,2,4-triazol-3-yl)propyl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 175476257 |
| Molecular Formula | C16H15BrFN5OS |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | O-[2-(3-bromophenyl)-2-fluoro-1-(4-methyl-1,2,4-triazol-3-yl)propyl] imidazole-1-carbothioate |
| SMILES | Cn1cnnc1C(OC(=S)n1ccnc1)C(C)(F)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H15BrFN5OS/c1-16(18,11-4-3-5-12(17)8-11)13(14-21-20-10-22(14)2)24-15(25)23-7-6-19-9-23/h3-10,13H,1-2H3 |
| InChIKey | ZGJDQZAKBLHYKK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|