C10H10F3NO3 — CID 175477452
methyl 2-amino-3-(1,2,2-trifluoroethoxy)benzoate (PubChem CID 175477452) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is methyl 2-amino-3-(1,2,2-trifluoroethoxy)benzoate.
| Compound Name | methyl 2-amino-3-(1,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 175477452 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | methyl 2-amino-3-(1,2,2-trifluoroethoxy)benzoate |
| SMILES | COC(=O)c1cccc(OC(F)C(F)F)c1N |
| InChI | InChI=1S/C10H10F3NO3/c1-16-10(15)5-3-2-4-6(7(5)14)17-9(13)8(11)12/h2-4,8-9H,14H2,1H3 |
| InChIKey | ADMASXWIOHYPFF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|