About 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate
6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate (PubChem CID 175479097) has the molecular formula C24H48O6
and a molecular weight of 432.64 g/mol. Its IUPAC name is 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate.
Molecular Properties
| Compound Name | 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate |
| PubChem CID | 175479097 |
| Molecular Formula | C24H48O6 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate |
| SMILES | CC(C)CCCCCOC(=O)C(CCCCCC(C)C)OCCOCCOCCO |
| InChI | InChI=1S/C24H48O6/c1-21(2)11-7-5-9-13-23(29-20-19-28-18-17-27-16-14-25)24(26)30-15-10-6-8-12-22(3)4/h21-23,25H,5-20H2,1-4H3 |
| InChIKey | XPTUBYIUCCOGMP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate?
The IUPAC name of 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate (CID 175479097) is 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate.
What is the SMILES notation for 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate?
The canonical SMILES for 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate is CC(C)CCCCCOC(=O)C(CCCCCC(C)C)OCCOCCOCCO.
What is the InChIKey of 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate?
The InChIKey is XPTUBYIUCCOGMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48O6/c1-21(2)11-7-5-9-13-23(29-20-19-28-18-17-27-16-14-25)24(26)30-15-10-6-8-12-22(3)4/h21-23,25H,5-20H2,1-4H3.
What are the key properties of 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate?
6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate has a molecular weight of 432.64 g/mol, XLogP of 4.76, 22 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptyl 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]-8-methylnonanoate is sourced from PubChem (CID 175479097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).