C10H13N3O3 — CID 175479949
1-(5-hydroxy-2-pyridinyl)-3-(oxolan-3-yl)urea (PubChem CID 175479949) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 1-(5-hydroxy-2-pyridinyl)-3-(oxolan-3-yl)urea.
| Compound Name | 1-(5-hydroxy-2-pyridinyl)-3-(oxolan-3-yl)urea |
|---|---|
| PubChem CID | 175479949 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-(5-hydroxy-2-pyridinyl)-3-(oxolan-3-yl)urea |
| SMILES | O=C(Nc1ccc(O)cn1)NC1CCOC1 |
| InChI | InChI=1S/C10H13N3O3/c14-8-1-2-9(11-5-8)13-10(15)12-7-3-4-16-6-7/h1-2,5,7,14H,3-4,6H2,(H2,11,12,13,15) |
| InChIKey | PFWHQFXVHROVDH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |