C30H29NO6S — CID 175479984
[[7-(1-benzofuran-7-yl)-5-[[2-(carboxymethyl)phenoxy]methyl]-1-benzofuran-3-yl]methylamino]-tert-butyl-oxidosulfanium (PubChem CID 175479984) has the molecular formula C30H29NO6S and a molecular weight of 531.63 g/mol. Its IUPAC name is [[7-(1-benzofuran-7-yl)-5-[[2-(carboxymethyl)phenoxy]methyl]-1-benzofuran-3-yl]methylamino]-tert-butyl-oxidosulfanium.
| Compound Name | [[7-(1-benzofuran-7-yl)-5-[[2-(carboxymethyl)phenoxy]methyl]-1-benzofuran-3-yl]methylamino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175479984 |
| Molecular Formula | C30H29NO6S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | [[7-(1-benzofuran-7-yl)-5-[[2-(carboxymethyl)phenoxy]methyl]-1-benzofuran-3-yl]methylamino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NCc1coc2c(-c3cccc4ccoc34)cc(COc3ccccc3CC(=O)O)cc12 |
| InChI | InChI=1S/C30H29NO6S/c1-30(2,3)38(34)31-16-22-18-37-29-24(22)13-19(17-36-26-10-5-4-7-21(26)15-27(32)33)14-25(29)23-9-6-8-20-11-12-35-28(20)23/h4-14,18,31H,15-17H2,1-3H3,(H,32,33) |
| InChIKey | IENLICVVCHPJCX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|