C18H26O5 — CID 175480800
2-(2-tert-butyl-4-hydroxyphenoxy)carbonyl-2-methylhexanoic acid (PubChem CID 175480800) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-hydroxyphenoxy)carbonyl-2-methylhexanoic acid.
| Compound Name | 2-(2-tert-butyl-4-hydroxyphenoxy)carbonyl-2-methylhexanoic acid |
|---|---|
| PubChem CID | 175480800 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-(2-tert-butyl-4-hydroxyphenoxy)carbonyl-2-methylhexanoic acid |
| SMILES | CCCCC(C)(C(=O)O)C(=O)Oc1ccc(O)cc1C(C)(C)C |
| InChI | InChI=1S/C18H26O5/c1-6-7-10-18(5,15(20)21)16(22)23-14-9-8-12(19)11-13(14)17(2,3)4/h8-9,11,19H,6-7,10H2,1-5H3,(H,20,21) |
| InChIKey | VGWKUDOTCFGGDE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|