C13H16O4 — CID 90250863
[4-hydroxy-2-(2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate (PubChem CID 90250863) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [4-hydroxy-2-(2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-hydroxy-2-(2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90250863 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [4-hydroxy-2-(2-hydroxypropan-2-yl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(O)cc1C(C)(C)O |
| InChI | InChI=1S/C13H16O4/c1-8(2)12(15)17-11-6-5-9(14)7-10(11)13(3,4)16/h5-7,14,16H,1H2,2-4H3 |
| InChIKey | ABHLHBPPQUDELG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|