C36H42O8 — CID 158869616
[4-[1-[2,3-diethoxy-4-(2-methylprop-2-enoyloxy)phenyl]-1-phenylethyl]-2,3-diethoxyphenyl] 2-methylprop-2-enoate (PubChem CID 158869616) has the molecular formula C36H42O8 and a molecular weight of 602.72 g/mol. Its IUPAC name is [4-[1-[2,3-diethoxy-4-(2-methylprop-2-enoyloxy)phenyl]-1-phenylethyl]-2,3-diethoxyphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[1-[2,3-diethoxy-4-(2-methylprop-2-enoyloxy)phenyl]-1-phenylethyl]-2,3-diethoxyphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158869616 |
| Molecular Formula | C36H42O8 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | [4-[1-[2,3-diethoxy-4-(2-methylprop-2-enoyloxy)phenyl]-1-phenylethyl]-2,3-diethoxyphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(C)(c2ccccc2)c2ccc(OC(=O)C(=C)C)c(OCC)c2OCC)c(OCC)c1OCC |
| InChI | InChI=1S/C36H42O8/c1-10-39-30-26(19-21-28(32(30)41-12-3)43-34(37)23(5)6)36(9,25-17-15-14-16-18-25)27-20-22-29(44-35(38)24(7)8)33(42-13-4)31(27)40-11-2/h14-22H,5,7,10-13H2,1-4,6,8-9H3 |
| InChIKey | JBRHTPNQVJHTDL-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|