C31H40O8 — CID 67798557
[6-[1-[3,4-diethoxy-2-(2-methylprop-2-enoyloxy)phenyl]propyl]-2,3-diethoxyphenyl] 2-methylprop-2-enoate (PubChem CID 67798557) has the molecular formula C31H40O8 and a molecular weight of 540.65 g/mol. Its IUPAC name is [6-[1-[3,4-diethoxy-2-(2-methylprop-2-enoyloxy)phenyl]propyl]-2,3-diethoxyphenyl] 2-methylprop-2-enoate.
| Compound Name | [6-[1-[3,4-diethoxy-2-(2-methylprop-2-enoyloxy)phenyl]propyl]-2,3-diethoxyphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67798557 |
| Molecular Formula | C31H40O8 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | [6-[1-[3,4-diethoxy-2-(2-methylprop-2-enoyloxy)phenyl]propyl]-2,3-diethoxyphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(C(CC)c2ccc(OCC)c(OCC)c2OC(=O)C(=C)C)ccc(OCC)c1OCC |
| InChI | InChI=1S/C31H40O8/c1-10-21(22-15-17-24(34-11-2)28(36-13-4)26(22)38-30(32)19(6)7)23-16-18-25(35-12-3)29(37-14-5)27(23)39-31(33)20(8)9/h15-18,21H,6,8,10-14H2,1-5,7,9H3 |
| InChIKey | DXMXJFFDVNXFRN-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|