C45H50O8 — CID 87975556
[4-[9-[2,5-diethoxy-3-ethyl-4-(2-methylprop-2-enoyloxy)phenyl]fluoren-9-yl]-3,6-diethoxy-2-ethylphenyl] 2-methylprop-2-enoate (PubChem CID 87975556) has the molecular formula C45H50O8 and a molecular weight of 718.89 g/mol. Its IUPAC name is [4-[9-[2,5-diethoxy-3-ethyl-4-(2-methylprop-2-enoyloxy)phenyl]fluoren-9-yl]-3,6-diethoxy-2-ethylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[9-[2,5-diethoxy-3-ethyl-4-(2-methylprop-2-enoyloxy)phenyl]fluoren-9-yl]-3,6-diethoxy-2-ethylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87975556 |
| Molecular Formula | C45H50O8 |
| Molecular Weight | 718.89 g/mol |
| Exact Mass | 718.35 |
| IUPAC Name | [4-[9-[2,5-diethoxy-3-ethyl-4-(2-methylprop-2-enoyloxy)phenyl]fluoren-9-yl]-3,6-diethoxy-2-ethylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(OCC)cc(C2(c3cc(OCC)c(OC(=O)C(=C)C)c(CC)c3OCC)c3ccccc3-c3ccccc32)c(OCC)c1CC |
| InChI | InChI=1S/C45H50O8/c1-11-29-39(50-15-5)35(25-37(48-13-3)41(29)52-43(46)27(7)8)45(33-23-19-17-21-31(33)32-22-18-20-24-34(32)45)36-26-38(49-14-4)42(53-44(47)28(9)10)30(12-2)40(36)51-16-6/h17-26H,7,9,11-16H2,1-6,8,10H3 |
| InChIKey | GZVHHOLCEMZYHB-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.89 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|