C45H50O10 — CID 87448243
[2,3,6-triethoxy-4-[9-[2,3,5-triethoxy-4-(2-methylprop-2-enoyloxy)phenyl]fluoren-9-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 87448243) has the molecular formula C45H50O10 and a molecular weight of 750.88 g/mol. Its IUPAC name is [2,3,6-triethoxy-4-[9-[2,3,5-triethoxy-4-(2-methylprop-2-enoyloxy)phenyl]fluoren-9-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2,3,6-triethoxy-4-[9-[2,3,5-triethoxy-4-(2-methylprop-2-enoyloxy)phenyl]fluoren-9-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87448243 |
| Molecular Formula | C45H50O10 |
| Molecular Weight | 750.88 g/mol |
| Exact Mass | 750.34 |
| IUPAC Name | [2,3,6-triethoxy-4-[9-[2,3,5-triethoxy-4-(2-methylprop-2-enoyloxy)phenyl]fluoren-9-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(OCC)cc(C2(c3cc(OCC)c(OC(=O)C(=C)C)c(OCC)c3OCC)c3ccccc3-c3ccccc32)c(OCC)c1OCC |
| InChI | InChI=1S/C45H50O10/c1-11-48-35-25-33(37(50-13-3)41(52-15-5)39(35)54-43(46)27(7)8)45(31-23-19-17-21-29(31)30-22-18-20-24-32(30)45)34-26-36(49-12-2)40(55-44(47)28(9)10)42(53-16-6)38(34)51-14-4/h17-26H,7,9,11-16H2,1-6,8,10H3 |
| InChIKey | YSHQGPBIOSNVHA-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.88 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|