About 2,5-dinitro-1H-imidazole;N-methylmethanamine
2,5-dinitro-1H-imidazole;N-methylmethanamine (PubChem CID 175484751) has the molecular formula C5H9N5O4
and a molecular weight of 203.16 g/mol. Its IUPAC name is 2,5-dinitro-1H-imidazole;N-methylmethanamine.
Molecular Properties
| Compound Name | 2,5-dinitro-1H-imidazole;N-methylmethanamine |
| PubChem CID | 175484751 |
| Molecular Formula | C5H9N5O4 |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2,5-dinitro-1H-imidazole;N-methylmethanamine |
| SMILES | CNC.O=[N+]([O-])c1cnc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C3H2N4O4.C2H7N/c8-6(9)2-1-4-3(5-2)7(10)11;1-3-2/h1H,(H,4,5);3H,1-2H3 |
| InChIKey | QJLJFHQBGWFLLS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dinitro-1H-imidazole;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dinitro-1H-imidazole;N-methylmethanamine?
The IUPAC name of 2,5-dinitro-1H-imidazole;N-methylmethanamine (CID 175484751) is 2,5-dinitro-1H-imidazole;N-methylmethanamine.
What is the SMILES notation for 2,5-dinitro-1H-imidazole;N-methylmethanamine?
The canonical SMILES for 2,5-dinitro-1H-imidazole;N-methylmethanamine is CNC.O=[N+]([O-])c1cnc([N+](=O)[O-])[nH]1.
What is the InChIKey of 2,5-dinitro-1H-imidazole;N-methylmethanamine?
The InChIKey is QJLJFHQBGWFLLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N4O4.C2H7N/c8-6(9)2-1-4-3(5-2)7(10)11;1-3-2/h1H,(H,4,5);3H,1-2H3.
What are the key properties of 2,5-dinitro-1H-imidazole;N-methylmethanamine?
2,5-dinitro-1H-imidazole;N-methylmethanamine has a molecular weight of 203.16 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dinitro-1H-imidazole;N-methylmethanamine is sourced from PubChem (CID 175484751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).