C9H12N4O3 — CID 20738543
N-[3-(5-nitro-1H-imidazol-2-yl)cyclobutyl]acetamide (PubChem CID 20738543) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is N-[3-(5-nitro-1H-imidazol-2-yl)cyclobutyl]acetamide.
| Compound Name | N-[3-(5-nitro-1H-imidazol-2-yl)cyclobutyl]acetamide |
|---|---|
| PubChem CID | 20738543 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-[3-(5-nitro-1H-imidazol-2-yl)cyclobutyl]acetamide |
| SMILES | CC(=O)NC1CC(c2ncc([N+](=O)[O-])[nH]2)C1 |
| InChI | InChI=1S/C9H12N4O3/c1-5(14)11-7-2-6(3-7)9-10-4-8(12-9)13(15)16/h4,6-7H,2-3H2,1H3,(H,10,12)(H,11,14) |
| InChIKey | BRQSOJOVLYECNW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|