C12H14N10O4 — CID 136828456
(Z)-1-(5-nitro-1H-imidazol-2-yl)-N-[4-[(Z)-(5-nitro-1H-imidazol-2-yl)methylideneamino]piperazin-1-yl]methanimine (PubChem CID 136828456) has the molecular formula C12H14N10O4 and a molecular weight of 362.31 g/mol. Its IUPAC name is (Z)-1-(5-nitro-1H-imidazol-2-yl)-N-[4-[(Z)-(5-nitro-1H-imidazol-2-yl)methylideneamino]piperazin-1-yl]methanimine.
| Compound Name | (Z)-1-(5-nitro-1H-imidazol-2-yl)-N-[4-[(Z)-(5-nitro-1H-imidazol-2-yl)methylideneamino]piperazin-1-yl]methanimine |
|---|---|
| PubChem CID | 136828456 |
| Molecular Formula | C12H14N10O4 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (Z)-1-(5-nitro-1H-imidazol-2-yl)-N-[4-[(Z)-(5-nitro-1H-imidazol-2-yl)methylideneamino]piperazin-1-yl]methanimine |
| SMILES | O=[N+]([O-])c1cnc(/C=N\N2CCN(/N=C\c3ncc([N+](=O)[O-])[nH]3)CC2)[nH]1 |
| InChI | InChI=1S/C12H14N10O4/c23-21(24)11-7-13-9(17-11)5-15-19-1-2-20(4-3-19)16-6-10-14-8-12(18-10)22(25)26/h5-8H,1-4H2,(H,13,17)(H,14,18)/b15-5-,16-6- |
| InChIKey | XBGGOBVVCUMPSN-KNBRTIFXSA-N |
| XLogP | -0.07 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|