About N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate
N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate (PubChem CID 175484798) has the molecular formula C10H17NO5S
and a molecular weight of 263.31 g/mol. Its IUPAC name is N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate.
Molecular Properties
| Compound Name | N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate |
| PubChem CID | 175484798 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate |
| SMILES | CCONCc1ccccc1.COS(=O)(=O)O |
| InChI | InChI=1S/C9H13NO.CH4O4S/c1-2-11-10-8-9-6-4-3-5-7-9;1-5-6(2,3)4/h3-7,10H,2,8H2,1H3;1H3,(H,2,3,4) |
| InChIKey | LNVUYCFKLFSFBG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate?
The IUPAC name of N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate (CID 175484798) is N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate.
What is the SMILES notation for N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate?
The canonical SMILES for N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate is CCONCc1ccccc1.COS(=O)(=O)O.
What is the InChIKey of N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate?
The InChIKey is LNVUYCFKLFSFBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.CH4O4S/c1-2-11-10-8-9-6-4-3-5-7-9;1-5-6(2,3)4/h3-7,10H,2,8H2,1H3;1H3,(H,2,3,4).
What are the key properties of N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate?
N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate has a molecular weight of 263.31 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-1-phenylmethanamine;methyl hydrogen sulfate is sourced from PubChem (CID 175484798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).