C16H26NO4S+ — CID 174608123
benzyl-ethyl-bis(prop-2-enyl)azanium;methyl hydrogen sulfate (PubChem CID 174608123) has the molecular formula C16H26NO4S+ and a molecular weight of 328.45 g/mol. Its IUPAC name is benzyl-ethyl-bis(prop-2-enyl)azanium;methyl hydrogen sulfate.
| Compound Name | benzyl-ethyl-bis(prop-2-enyl)azanium;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 174608123 |
| Molecular Formula | C16H26NO4S+ |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | benzyl-ethyl-bis(prop-2-enyl)azanium;methyl hydrogen sulfate |
| SMILES | C=CC[N+](CC)(CC=C)Cc1ccccc1.COS(=O)(=O)O |
| InChI | InChI=1S/C15H22N.CH4O4S/c1-4-12-16(6-3,13-5-2)14-15-10-8-7-9-11-15;1-5-6(2,3)4/h4-5,7-11H,1-2,6,12-14H2,3H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | KYOJZCLLQANTHZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|