C22H38BrN2+ — CID 54610948
[4-[[diethyl(prop-2-enyl)azaniumyl]methyl]phenyl]methyl-diethyl-prop-2-enylazanium bromide (PubChem CID 54610948) has the molecular formula C22H38BrN2+ and a molecular weight of 410.46 g/mol. Its IUPAC name is [4-[[diethyl(prop-2-enyl)azaniumyl]methyl]phenyl]methyl-diethyl-prop-2-enylazanium bromide.
| Compound Name | [4-[[diethyl(prop-2-enyl)azaniumyl]methyl]phenyl]methyl-diethyl-prop-2-enylazanium bromide |
|---|---|
| PubChem CID | 54610948 |
| Molecular Formula | C22H38BrN2+ |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | [4-[[diethyl(prop-2-enyl)azaniumyl]methyl]phenyl]methyl-diethyl-prop-2-enylazanium bromide |
| SMILES | C=CC[N+](CC)(CC)Cc1ccc(C[N+](CC)(CC)CC=C)cc1.[Br-] |
| InChI | InChI=1S/C22H38N2.BrH/c1-7-17-23(9-3,10-4)19-21-13-15-22(16-14-21)20-24(11-5,12-6)18-8-2;/h7-8,13-16H,1-2,9-12,17-20H2,3-6H3;1H/q+2;/p-1 |
| InChIKey | HFVPOWYJQXRADD-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|