C17H16ClF3O6S — CID 175486411
[(3-chlorophenyl)-(2,4,6-trimethoxyphenyl)methyl] trifluoromethanesulfonate (PubChem CID 175486411) has the molecular formula C17H16ClF3O6S and a molecular weight of 440.82 g/mol. Its IUPAC name is [(3-chlorophenyl)-(2,4,6-trimethoxyphenyl)methyl] trifluoromethanesulfonate.
| Compound Name | [(3-chlorophenyl)-(2,4,6-trimethoxyphenyl)methyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175486411 |
| Molecular Formula | C17H16ClF3O6S |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | [(3-chlorophenyl)-(2,4,6-trimethoxyphenyl)methyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OC)c(C(OS(=O)(=O)C(F)(F)F)c2cccc(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C17H16ClF3O6S/c1-24-12-8-13(25-2)15(14(9-12)26-3)16(10-5-4-6-11(18)7-10)27-28(22,23)17(19,20)21/h4-9,16H,1-3H3 |
| InChIKey | ZLTFYQWRGZPDDF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|