C36H31F3O6S — CID 175946037
[(2,4-dimethoxy-6-trityloxyphenyl)-(4-methylphenyl)methyl] trifluoromethanesulfonate (PubChem CID 175946037) has the molecular formula C36H31F3O6S and a molecular weight of 648.70 g/mol. Its IUPAC name is [(2,4-dimethoxy-6-trityloxyphenyl)-(4-methylphenyl)methyl] trifluoromethanesulfonate.
| Compound Name | [(2,4-dimethoxy-6-trityloxyphenyl)-(4-methylphenyl)methyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175946037 |
| Molecular Formula | C36H31F3O6S |
| Molecular Weight | 648.70 g/mol |
| Exact Mass | 648.18 |
| IUPAC Name | [(2,4-dimethoxy-6-trityloxyphenyl)-(4-methylphenyl)methyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OC)c(C(OS(=O)(=O)C(F)(F)F)c2ccc(C)cc2)c(OC(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C36H31F3O6S/c1-25-19-21-26(22-20-25)34(45-46(40,41)36(37,38)39)33-31(43-3)23-30(42-2)24-32(33)44-35(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-24,34H,1-3H3 |
| InChIKey | GQWBLUUBSJVFOD-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.70 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|