C11H27N3O — CID 175487016
2,3-dimethylbutane-2,3-diamine;4-methylmorpholine (PubChem CID 175487016) has the molecular formula C11H27N3O and a molecular weight of 217.36 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diamine;4-methylmorpholine.
| Compound Name | 2,3-dimethylbutane-2,3-diamine;4-methylmorpholine |
|---|---|
| PubChem CID | 175487016 |
| Molecular Formula | C11H27N3O |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.22 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diamine;4-methylmorpholine |
| SMILES | CC(C)(N)C(C)(C)N.CN1CCOCC1 |
| InChI | InChI=1S/C6H16N2.C5H11NO/c1-5(2,7)6(3,4)8;1-6-2-4-7-5-3-6/h7-8H2,1-4H3;2-5H2,1H3 |
| InChIKey | MAALBITZHDUMPG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |