C30H61N — CID 175488077
(2R)-N,N-dimethyl-2-(1-octylcyclopropyl)heptadecan-8-amine (PubChem CID 175488077) has the molecular formula C30H61N and a molecular weight of 435.83 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-(1-octylcyclopropyl)heptadecan-8-amine.
| Compound Name | (2R)-N,N-dimethyl-2-(1-octylcyclopropyl)heptadecan-8-amine |
|---|---|
| PubChem CID | 175488077 |
| Molecular Formula | C30H61N |
| Molecular Weight | 435.83 g/mol |
| Exact Mass | 435.48 |
| IUPAC Name | (2R)-N,N-dimethyl-2-(1-octylcyclopropyl)heptadecan-8-amine |
| SMILES | CCCCCCCCCC(CCCCC[C@@H](C)C1(CCCCCCCC)CC1)N(C)C |
| InChI | InChI=1S/C30H61N/c1-6-8-10-12-14-15-19-23-29(31(4)5)24-20-17-18-22-28(3)30(26-27-30)25-21-16-13-11-9-7-2/h28-29H,6-27H2,1-5H3/t28-,29?/m1/s1 |
| InChIKey | MRZLFFWHBVTJMX-FICMROCWSA-N |
| XLogP | 10.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.83 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|