C18H23FN2O3 — CID 175490496
ethyl 1-[3-fluoro-1-(4-methoxyphenyl)-3-methylbutyl]pyrazole-4-carboxylate (PubChem CID 175490496) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is ethyl 1-[3-fluoro-1-(4-methoxyphenyl)-3-methylbutyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[3-fluoro-1-(4-methoxyphenyl)-3-methylbutyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 175490496 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethyl 1-[3-fluoro-1-(4-methoxyphenyl)-3-methylbutyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C(CC(C)(C)F)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C18H23FN2O3/c1-5-24-17(22)14-11-20-21(12-14)16(10-18(2,3)19)13-6-8-15(23-4)9-7-13/h6-9,11-12,16H,5,10H2,1-4H3 |
| InChIKey | GFOUSOIHUMBXFQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |