C18H14N4 — CID 175490539
2,4-diphenyl-7H-pyrrolo[2,3-d]pyrimidin-6-amine (PubChem CID 175490539) has the molecular formula C18H14N4 and a molecular weight of 286.34 g/mol. Its IUPAC name is 2,4-diphenyl-7H-pyrrolo[2,3-d]pyrimidin-6-amine.
| Compound Name | 2,4-diphenyl-7H-pyrrolo[2,3-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 175490539 |
| Molecular Formula | C18H14N4 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2,4-diphenyl-7H-pyrrolo[2,3-d]pyrimidin-6-amine |
| SMILES | Nc1cc2c(-c3ccccc3)nc(-c3ccccc3)nc2[nH]1 |
| InChI | InChI=1S/C18H14N4/c19-15-11-14-16(12-7-3-1-4-8-12)21-17(22-18(14)20-15)13-9-5-2-6-10-13/h1-11H,19H2,(H,20,21,22) |
| InChIKey | CLPOWFUXQKCUTL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |