C17H12N2O — CID 175492281
3-anthracen-1-yl-4-methyl-1,2,5-oxadiazole (PubChem CID 175492281) has the molecular formula C17H12N2O and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-anthracen-1-yl-4-methyl-1,2,5-oxadiazole.
| Compound Name | 3-anthracen-1-yl-4-methyl-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 175492281 |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 3-anthracen-1-yl-4-methyl-1,2,5-oxadiazole |
| SMILES | Cc1nonc1-c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C17H12N2O/c1-11-17(19-20-18-11)15-8-4-7-14-9-12-5-2-3-6-13(12)10-16(14)15/h2-10H,1H3 |
| InChIKey | IAVPYWTWRBSGJC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|