About benzene;dichloropalladium;phosphate
benzene;dichloropalladium;phosphate (PubChem CID 175492461) has the molecular formula C6H5Cl2O4PPd-4
and a molecular weight of 349.40 g/mol. Its IUPAC name is benzene;dichloropalladium;phosphate.
Molecular Properties
| Compound Name | benzene;dichloropalladium;phosphate |
| PubChem CID | 175492461 |
| Molecular Formula | C6H5Cl2O4PPd-4 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 347.84 |
| IUPAC Name | benzene;dichloropalladium;phosphate |
| SMILES | Cl[Pd]Cl.O=P([O-])([O-])[O-].[c-]1ccccc1 |
| InChI | InChI=1S/C6H5.2ClH.H3O4P.Pd/c1-2-4-6-5-3-1;;;1-5(2,3)4;/h1-5H;2*1H;(H3,1,2,3,4);/q-1;;;;+2/p-5 |
| InChIKey | DPLJFEZELWVXMR-UHFFFAOYSA-I |
| XLogP | 0.04 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;dichloropalladium;phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;dichloropalladium;phosphate?
The IUPAC name of benzene;dichloropalladium;phosphate (CID 175492461) is benzene;dichloropalladium;phosphate.
What is the SMILES notation for benzene;dichloropalladium;phosphate?
The canonical SMILES for benzene;dichloropalladium;phosphate is Cl[Pd]Cl.O=P([O-])([O-])[O-].[c-]1ccccc1.
What is the InChIKey of benzene;dichloropalladium;phosphate?
The InChIKey is DPLJFEZELWVXMR-UHFFFAOYSA-I. The full InChI is InChI=1S/C6H5.2ClH.H3O4P.Pd/c1-2-4-6-5-3-1;;;1-5(2,3)4;/h1-5H;2*1H;(H3,1,2,3,4);/q-1;;;;+2/p-5.
What are the key properties of benzene;dichloropalladium;phosphate?
benzene;dichloropalladium;phosphate has a molecular weight of 349.40 g/mol, XLogP of 0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;dichloropalladium;phosphate is sourced from PubChem (CID 175492461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).