C15H22N2O4S — CID 175492531
2-[[3-(dimethylamino)propyl-prop-2-enoylamino]methyl]benzenesulfonic acid (PubChem CID 175492531) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-[[3-(dimethylamino)propyl-prop-2-enoylamino]methyl]benzenesulfonic acid.
| Compound Name | 2-[[3-(dimethylamino)propyl-prop-2-enoylamino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175492531 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[[3-(dimethylamino)propyl-prop-2-enoylamino]methyl]benzenesulfonic acid |
| SMILES | C=CC(=O)N(CCCN(C)C)Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C15H22N2O4S/c1-4-15(18)17(11-7-10-16(2)3)12-13-8-5-6-9-14(13)22(19,20)21/h4-6,8-9H,1,7,10-12H2,2-3H3,(H,19,20,21) |
| InChIKey | YKEHVVVOHFBQAR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|