C22H19ClN3NaO6 — CID 175492561
sodium 3-[[[3-(2-chlorophenoxy)phenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoate (PubChem CID 175492561) has the molecular formula C22H19ClN3NaO6 and a molecular weight of 479.85 g/mol. Its IUPAC name is sodium 3-[[[3-(2-chlorophenoxy)phenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoate.
| Compound Name | sodium 3-[[[3-(2-chlorophenoxy)phenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 175492561 |
| Molecular Formula | C22H19ClN3NaO6 |
| Molecular Weight | 479.85 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | sodium 3-[[[3-(2-chlorophenoxy)phenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoate |
| SMILES | CN1C=CC(=O)[C@H](N(C(=O)NCCC(=O)[O-])c2cccc(Oc3ccccc3Cl)c2)C1=O.[Na+] |
| InChI | InChI=1S/C22H20ClN3O6.Na/c1-25-12-10-17(27)20(21(25)30)26(22(31)24-11-9-19(28)29)14-5-4-6-15(13-14)32-18-8-3-2-7-16(18)23;/h2-8,10,12-13,20H,9,11H2,1H3,(H,24,31)(H,28,29);/q;+1/p-1/t20-;/m0./s1 |
| InChIKey | QSOLLMKHUVGNHC-BDQAORGHSA-M |
| XLogP | -1.28 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.85 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|