C23H22ClN3O5 — CID 175002849
3-[[[3-(3-chlorophenyl)-4-methylphenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid (PubChem CID 175002849) has the molecular formula C23H22ClN3O5 and a molecular weight of 455.90 g/mol. Its IUPAC name is 3-[[[3-(3-chlorophenyl)-4-methylphenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[[3-(3-chlorophenyl)-4-methylphenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175002849 |
| Molecular Formula | C23H22ClN3O5 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 3-[[[3-(3-chlorophenyl)-4-methylphenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid |
| SMILES | Cc1ccc(N(C(=O)NCCC(=O)O)[C@H]2C(=O)C=CN(C)C2=O)cc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H22ClN3O5/c1-14-6-7-17(13-18(14)15-4-3-5-16(24)12-15)27(23(32)25-10-8-20(29)30)21-19(28)9-11-26(2)22(21)31/h3-7,9,11-13,21H,8,10H2,1-2H3,(H,25,32)(H,29,30)/t21-/m0/s1 |
| InChIKey | FLBHAIGDBZPRLA-NRFANRHFSA-N |
| XLogP | 3.23 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|