C24H19F2N3O5S — CID 175006248
3-[[[3-(2,4-difluorophenyl)phenyl]-[(6S)-4-methyl-5,7-dioxothieno[3,2-b]pyridin-6-yl]carbamoyl]amino]propanoic acid (PubChem CID 175006248) has the molecular formula C24H19F2N3O5S and a molecular weight of 499.50 g/mol. Its IUPAC name is 3-[[[3-(2,4-difluorophenyl)phenyl]-[(6S)-4-methyl-5,7-dioxothieno[3,2-b]pyridin-6-yl]carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[[3-(2,4-difluorophenyl)phenyl]-[(6S)-4-methyl-5,7-dioxothieno[3,2-b]pyridin-6-yl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175006248 |
| Molecular Formula | C24H19F2N3O5S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 3-[[[3-(2,4-difluorophenyl)phenyl]-[(6S)-4-methyl-5,7-dioxothieno[3,2-b]pyridin-6-yl]carbamoyl]amino]propanoic acid |
| SMILES | CN1C(=O)[C@@H](N(C(=O)NCCC(=O)O)c2cccc(-c3ccc(F)cc3F)c2)C(=O)c2sccc21 |
| InChI | InChI=1S/C24H19F2N3O5S/c1-28-18-8-10-35-22(18)21(32)20(23(28)33)29(24(34)27-9-7-19(30)31)15-4-2-3-13(11-15)16-6-5-14(25)12-17(16)26/h2-6,8,10-12,20H,7,9H2,1H3,(H,27,34)(H,30,31)/t20-/m0/s1 |
| InChIKey | NJGJSKSACWKFMT-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|