C25H24N3NaO6 — CID 175562782
sodium 3-[[[3-(4-acetylphenyl)phenyl]-(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoate (PubChem CID 175562782) has the molecular formula C25H24N3NaO6 and a molecular weight of 485.47 g/mol. Its IUPAC name is sodium 3-[[[3-(4-acetylphenyl)phenyl]-(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoate.
| Compound Name | sodium 3-[[[3-(4-acetylphenyl)phenyl]-(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 175562782 |
| Molecular Formula | C25H24N3NaO6 |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | sodium 3-[[[3-(4-acetylphenyl)phenyl]-(1,5-dimethyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoate |
| SMILES | CC(=O)c1ccc(-c2cccc(N(C(=O)NCCC(=O)[O-])C3C(=O)C(C)=CN(C)C3=O)c2)cc1.[Na+] |
| InChI | InChI=1S/C25H25N3O6.Na/c1-15-14-27(3)24(33)22(23(15)32)28(25(34)26-12-11-21(30)31)20-6-4-5-19(13-20)18-9-7-17(8-10-18)16(2)29;/h4-10,13-14,22H,11-12H2,1-3H3,(H,26,34)(H,30,31);/q;+1/p-1 |
| InChIKey | AFAJYANHJMHPGY-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|