C23H21F2N3O5 — CID 175004688
3-[[[3-(2,4-difluorophenyl)phenyl]-[(3S)-1-ethyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid (PubChem CID 175004688) has the molecular formula C23H21F2N3O5 and a molecular weight of 457.43 g/mol. Its IUPAC name is 3-[[[3-(2,4-difluorophenyl)phenyl]-[(3S)-1-ethyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[[3-(2,4-difluorophenyl)phenyl]-[(3S)-1-ethyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175004688 |
| Molecular Formula | C23H21F2N3O5 |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 3-[[[3-(2,4-difluorophenyl)phenyl]-[(3S)-1-ethyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid |
| SMILES | CCN1C=CC(=O)[C@H](N(C(=O)NCCC(=O)O)c2cccc(-c3ccc(F)cc3F)c2)C1=O |
| InChI | InChI=1S/C23H21F2N3O5/c1-2-27-11-9-19(29)21(22(27)32)28(23(33)26-10-8-20(30)31)16-5-3-4-14(12-16)17-7-6-15(24)13-18(17)25/h3-7,9,11-13,21H,2,8,10H2,1H3,(H,26,33)(H,30,31)/t21-/m0/s1 |
| InChIKey | PGNZLZSVOAHOSU-NRFANRHFSA-N |
| XLogP | 2.94 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|