C22H22N4O6 — CID 175005524
3-[[[3-(6-methoxy-3-pyridinyl)phenyl]-(1-methyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoic acid (PubChem CID 175005524) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is 3-[[[3-(6-methoxy-3-pyridinyl)phenyl]-(1-methyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[[3-(6-methoxy-3-pyridinyl)phenyl]-(1-methyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175005524 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-[[[3-(6-methoxy-3-pyridinyl)phenyl]-(1-methyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoic acid |
| SMILES | COc1ccc(-c2cccc(N(C(=O)NCCC(=O)O)C3C(=O)C=CN(C)C3=O)c2)cn1 |
| InChI | InChI=1S/C22H22N4O6/c1-25-11-9-17(27)20(21(25)30)26(22(31)23-10-8-19(28)29)16-5-3-4-14(12-16)15-6-7-18(32-2)24-13-15/h3-7,9,11-13,20H,8,10H2,1-2H3,(H,23,31)(H,28,29) |
| InChIKey | YVUHNSFAIXDJOH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|