C21H21N3O6S — CID 175004843
3-[[[5-(3-methoxyphenyl)thiophen-2-yl]-(1-methyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoic acid (PubChem CID 175004843) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is 3-[[[5-(3-methoxyphenyl)thiophen-2-yl]-(1-methyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[[5-(3-methoxyphenyl)thiophen-2-yl]-(1-methyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175004843 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 3-[[[5-(3-methoxyphenyl)thiophen-2-yl]-(1-methyl-2,4-dioxo-3-pyridinyl)carbamoyl]amino]propanoic acid |
| SMILES | COc1cccc(-c2ccc(N(C(=O)NCCC(=O)O)C3C(=O)C=CN(C)C3=O)s2)c1 |
| InChI | InChI=1S/C21H21N3O6S/c1-23-11-9-15(25)19(20(23)28)24(21(29)22-10-8-18(26)27)17-7-6-16(31-17)13-4-3-5-14(12-13)30-2/h3-7,9,11-12,19H,8,10H2,1-2H3,(H,22,29)(H,26,27) |
| InChIKey | WOPSJRVCOJPCHR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|