C24H25N3O5 — CID 175002153
3-[[[4-(2,6-dimethylphenyl)phenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid (PubChem CID 175002153) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[[[4-(2,6-dimethylphenyl)phenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid.
| Compound Name | 3-[[[4-(2,6-dimethylphenyl)phenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175002153 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-[[[4-(2,6-dimethylphenyl)phenyl]-[(3S)-1-methyl-2,4-dioxo-3-pyridinyl]carbamoyl]amino]propanoic acid |
| SMILES | Cc1cccc(C)c1-c1ccc(N(C(=O)NCCC(=O)O)[C@H]2C(=O)C=CN(C)C2=O)cc1 |
| InChI | InChI=1S/C24H25N3O5/c1-15-5-4-6-16(2)21(15)17-7-9-18(10-8-17)27(24(32)25-13-11-20(29)30)22-19(28)12-14-26(3)23(22)31/h4-10,12,14,22H,11,13H2,1-3H3,(H,25,32)(H,29,30)/t22-/m0/s1 |
| InChIKey | HILFMIBGKZXUGV-QFIPXVFZSA-N |
| XLogP | 2.88 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|